C13H22N3O+ — CID 21079086
1-(azepan-1-yl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone (PubChem CID 21079086) has the molecular formula C13H22N3O+ and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone.
| Compound Name | 1-(azepan-1-yl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 21079086 |
| Molecular Formula | C13H22N3O+ |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-(azepan-1-yl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone |
| SMILES | Cc1n(CC(=O)N2CCCCCC2)cc[n+]1C |
| InChI | InChI=1S/C13H22N3O/c1-12-14(2)9-10-16(12)11-13(17)15-7-5-3-4-6-8-15/h9-10H,3-8,11H2,1-2H3/q+1 |
| InChIKey | MCOVXPIHEXBVFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|