C17H23ClN4O — CID 87584525
2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone chloride (PubChem CID 87584525) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone chloride.
| Compound Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone chloride |
|---|---|
| PubChem CID | 87584525 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-(2,3-dimethylimidazol-3-ium-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone chloride |
| SMILES | Cc1n(CC(=O)N2CCN(c3ccccc3)CC2)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C17H23N4O.ClH/c1-15-18(2)8-9-21(15)14-17(22)20-12-10-19(11-13-20)16-6-4-3-5-7-16;/h3-9H,10-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MSSNGALYIZCCFH-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 32.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|