C16H20N4O3 — CID 112778988
1-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 112778988) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112778988 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CC(=O)N2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C16H20N4O3/c1-17-11-15(22)20(16(17)23)12-14(21)19-9-7-18(8-10-19)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | BSKCIRDWIDEFAF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|