C18H24N5O4+ — CID 75278528
1,3-dimethyl-7-[2-oxo-2-[4-(prop-2-ynoxymethyl)piperidin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione (PubChem CID 75278528) has the molecular formula C18H24N5O4+ and a molecular weight of 374.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-[2-oxo-2-[4-(prop-2-ynoxymethyl)piperidin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[2-oxo-2-[4-(prop-2-ynoxymethyl)piperidin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75278528 |
| Molecular Formula | C18H24N5O4+ |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1,3-dimethyl-7-[2-oxo-2-[4-(prop-2-ynoxymethyl)piperidin-1-yl]ethyl]-5H-purin-7-ium-2,6-dione |
| SMILES | C#CCOCC1CCN(C(=O)C[N+]2=CN=C3C2C(=O)N(C)C(=O)N3C)CC1 |
| InChI | InChI=1S/C18H24N5O4/c1-4-9-27-11-13-5-7-22(8-6-13)14(24)10-23-12-19-16-15(23)17(25)21(3)18(26)20(16)2/h1,12-13,15H,5-11H2,2-3H3/q+1 |
| InChIKey | MOGPFFRZZVKFNP-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|