C13H22N2O3 — CID 90505607
N-(2-methoxyethyl)-3-(prop-2-ynoxymethyl)piperidine-1-carboxamide (PubChem CID 90505607) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(prop-2-ynoxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-3-(prop-2-ynoxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90505607 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-(2-methoxyethyl)-3-(prop-2-ynoxymethyl)piperidine-1-carboxamide |
| SMILES | C#CCOCC1CCCN(C(=O)NCCOC)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-3-8-18-11-12-5-4-7-15(10-12)13(16)14-6-9-17-2/h1,12H,4-11H2,2H3,(H,14,16) |
| InChIKey | UIFOMNSSNQTHKB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|