C19H25NO4 — CID 90505418
2-(3,4-dimethoxyphenyl)-1-[3-(prop-2-ynoxymethyl)piperidin-1-yl]ethanone (PubChem CID 90505418) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1-[3-(prop-2-ynoxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1-[3-(prop-2-ynoxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90505418 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1-[3-(prop-2-ynoxymethyl)piperidin-1-yl]ethanone |
| SMILES | C#CCOCC1CCCN(C(=O)Cc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C19H25NO4/c1-4-10-24-14-16-6-5-9-20(13-16)19(21)12-15-7-8-17(22-2)18(11-15)23-3/h1,7-8,11,16H,5-6,9-10,12-14H2,2-3H3 |
| InChIKey | VHDCYVVWQYPGLA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|