C10H12N5O2+ — CID 78180894
3-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)propanenitrile (PubChem CID 78180894) has the molecular formula C10H12N5O2+ and a molecular weight of 234.24 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)propanenitrile.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)propanenitrile |
|---|---|
| PubChem CID | 78180894 |
| Molecular Formula | C10H12N5O2+ |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)propanenitrile |
| SMILES | CN1C(=O)N(CCC#N)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C10H12N5O2/c1-13-6-12-8-7(13)9(16)15(5-3-4-11)10(17)14(8)2/h6-7H,3,5H2,1-2H3/q+1 |
| InChIKey | DEYSUCWZYYZIID-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|