C15H22N5O2+ — CID 75609033
2-(8-butyl-3-methyl-2,6-dioxo-7-propyl-5H-purin-7-ium-1-yl)acetonitrile (PubChem CID 75609033) has the molecular formula C15H22N5O2+ and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-(8-butyl-3-methyl-2,6-dioxo-7-propyl-5H-purin-7-ium-1-yl)acetonitrile.
| Compound Name | 2-(8-butyl-3-methyl-2,6-dioxo-7-propyl-5H-purin-7-ium-1-yl)acetonitrile |
|---|---|
| PubChem CID | 75609033 |
| Molecular Formula | C15H22N5O2+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(8-butyl-3-methyl-2,6-dioxo-7-propyl-5H-purin-7-ium-1-yl)acetonitrile |
| SMILES | CCCCC1=[N+](CCC)C2C(=O)N(CC#N)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C15H22N5O2/c1-4-6-7-11-17-13-12(19(11)9-5-2)14(21)20(10-8-16)15(22)18(13)3/h12H,4-7,9-10H2,1-3H3/q+1 |
| InChIKey | FJFYJDFKVVYLTB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|