C13H21N4O3+ — CID 73415422
1-(5-hydroxyhexyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73415422) has the molecular formula C13H21N4O3+ and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-(5-hydroxyhexyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-(5-hydroxyhexyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73415422 |
| Molecular Formula | C13H21N4O3+ |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-(5-hydroxyhexyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC(O)CCCCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C13H21N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8-10,18H,4-7H2,1-3H3/q+1 |
| InChIKey | GIOHEOBOMDBWMS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|