C21H28ClN6O3+ — CID 73327963
1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 73327963) has the molecular formula C21H28ClN6O3+ and a molecular weight of 447.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73327963 |
| Molecular Formula | C21H28ClN6O3+ |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-8-(3-morpholin-4-ylpropylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2Cl)C(=O)C2C1=NC(NCCCN1CCOCC1)=[N+]2C |
| InChI | InChI=1S/C21H27ClN6O3/c1-25-17-18(24-20(25)23-8-5-9-27-10-12-31-13-11-27)26(2)21(30)28(19(17)29)14-15-6-3-4-7-16(15)22/h3-4,6-7,17H,5,8-14H2,1-2H3/p+1 |
| InChIKey | VFSVGTIUOXBIJV-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|