C18H24ClN3O3 — CID 92696544
(2S)-1-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 92696544) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is (2S)-1-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 92696544 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2S)-1-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)[C@@H]1CCC(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H24ClN3O3/c19-15-4-2-1-3-14(15)13-22-16(5-6-17(22)23)18(24)20-7-8-21-9-11-25-12-10-21/h1-4,16H,5-13H2,(H,20,24)/t16-/m0/s1 |
| InChIKey | KYBCPILWRZBHGK-INIZCTEOSA-N |
| XLogP | 1.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |