C18H25ClN4O3 — CID 15994320
2-[3-[(2-chlorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 15994320) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 15994320 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-2-oxoimidazolidin-1-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(CN1CCN(Cc2ccccc2Cl)C1=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H25ClN4O3/c19-16-4-2-1-3-15(16)13-22-7-8-23(18(22)25)14-17(24)20-5-6-21-9-11-26-12-10-21/h1-4H,5-14H2,(H,20,24) |
| InChIKey | IUCVHMUCQNWAPA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |