C20H27N3O5 — CID 91955471
1-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 91955471) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91955471 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-N-(3-morpholin-4-ylpropyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)C1CCC(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H27N3O5/c24-19-5-3-16(20(25)21-6-1-7-22-8-10-26-11-9-22)23(19)13-15-2-4-17-18(12-15)28-14-27-17/h2,4,12,16H,1,3,5-11,13-14H2,(H,21,25) |
| InChIKey | ZWMJYDZUZCOUTN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|