C18H21ClN5O2+ — CID 78212656
7-[(2-chlorophenyl)methyl]-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione (PubChem CID 78212656) has the molecular formula C18H21ClN5O2+ and a molecular weight of 374.85 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methyl]-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione.
| Compound Name | 7-[(2-chlorophenyl)methyl]-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78212656 |
| Molecular Formula | C18H21ClN5O2+ |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 7-[(2-chlorophenyl)methyl]-1,3-dimethyl-8-pyrrolidin-1-ium-1-ylidene-5H-purine-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(=[N+]3CCCC3)N2Cc2ccccc2Cl)N(C)C1=O |
| InChI | InChI=1S/C18H21ClN5O2/c1-21-15-14(16(25)22(2)18(21)26)24(11-12-7-3-4-8-13(12)19)17(20-15)23-9-5-6-10-23/h3-4,7-8,14H,5-6,9-11H2,1-2H3/q+1 |
| InChIKey | IGUXMMHUKFSOFZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|