C19H31N6O3+ — CID 78202146
1-(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide (PubChem CID 78202146) has the molecular formula C19H31N6O3+ and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 78202146 |
| Molecular Formula | C19H31N6O3+ |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-8-ylidene)piperidin-1-ium-4-carboxamide |
| SMILES | CCCCCCN1C(=[N+]2CCC(C(N)=O)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H30N6O3/c1-4-5-6-7-10-25-14-16(22(2)19(28)23(3)17(14)27)21-18(25)24-11-8-13(9-12-24)15(20)26/h13-14H,4-12H2,1-3H3,(H-,20,26)/p+1 |
| InChIKey | NYSKXILKAFBLQJ-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|