C21H27N6O3+ — CID 78305013
8-(4-ethylpiperazin-1-ium-1-ylidene)-1,3-dimethyl-7-phenacyl-5H-purine-2,6-dione (PubChem CID 78305013) has the molecular formula C21H27N6O3+ and a molecular weight of 411.49 g/mol. Its IUPAC name is 8-(4-ethylpiperazin-1-ium-1-ylidene)-1,3-dimethyl-7-phenacyl-5H-purine-2,6-dione.
| Compound Name | 8-(4-ethylpiperazin-1-ium-1-ylidene)-1,3-dimethyl-7-phenacyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 78305013 |
| Molecular Formula | C21H27N6O3+ |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 8-(4-ethylpiperazin-1-ium-1-ylidene)-1,3-dimethyl-7-phenacyl-5H-purine-2,6-dione |
| SMILES | CCN1CC[N+](=C2N=C3C(C(=O)N(C)C(=O)N3C)N2CC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N6O3/c1-4-25-10-12-26(13-11-25)20-22-18-17(19(29)24(3)21(30)23(18)2)27(20)14-16(28)15-8-6-5-7-9-15/h5-9,17H,4,10-14H2,1-3H3/q+1 |
| InChIKey | ZTNYZJQBSQLJTD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|