C19H23N6O3+ — CID 75118152
3,7-dimethyl-1-phenacyl-8-piperazin-1-ium-1-ylidene-5H-purine-2,6-dione (PubChem CID 75118152) has the molecular formula C19H23N6O3+ and a molecular weight of 383.43 g/mol. Its IUPAC name is 3,7-dimethyl-1-phenacyl-8-piperazin-1-ium-1-ylidene-5H-purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-phenacyl-8-piperazin-1-ium-1-ylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 75118152 |
| Molecular Formula | C19H23N6O3+ |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3,7-dimethyl-1-phenacyl-8-piperazin-1-ium-1-ylidene-5H-purine-2,6-dione |
| SMILES | CN1C(=O)N(CC(=O)c2ccccc2)C(=O)C2C1=NC(=[N+]1CCNCC1)N2C |
| InChI | InChI=1S/C19H23N6O3/c1-22-15-16(21-18(22)24-10-8-20-9-11-24)23(2)19(28)25(17(15)27)12-14(26)13-6-4-3-5-7-13/h3-7,15,20H,8-12H2,1-2H3/q+1 |
| InChIKey | DRIAEZPRDKDGKP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|