C22H20N5O4+ — CID 73452004
6-(furan-2-ylmethyl)-4,7-dimethyl-2-phenacyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73452004) has the molecular formula C22H20N5O4+ and a molecular weight of 418.43 g/mol. Its IUPAC name is 6-(furan-2-ylmethyl)-4,7-dimethyl-2-phenacyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(furan-2-ylmethyl)-4,7-dimethyl-2-phenacyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73452004 |
| Molecular Formula | C22H20N5O4+ |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 6-(furan-2-ylmethyl)-4,7-dimethyl-2-phenacyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(n1Cc1ccco1)N=C1C2C(=O)N(CC(=O)c2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C22H20N5O4/c1-14-11-26-18-19(23-21(26)25(14)12-16-9-6-10-31-16)24(2)22(30)27(20(18)29)13-17(28)15-7-4-3-5-8-15/h3-11,18H,12-13H2,1-2H3/q+1 |
| InChIKey | CPWDUGONXZKEAY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|