C16H14BrN4O3+ — CID 78370316
2-[(4-bromophenyl)methyl]-4,7-dimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione (PubChem CID 78370316) has the molecular formula C16H14BrN4O3+ and a molecular weight of 390.22 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-4,7-dimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione.
| Compound Name | 2-[(4-bromophenyl)methyl]-4,7-dimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78370316 |
| Molecular Formula | C16H14BrN4O3+ |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-4,7-dimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(o1)N=C1C2C(=O)N(Cc2ccc(Br)cc2)C(=O)N1C |
| InChI | InChI=1S/C16H14BrN4O3/c1-9-7-20-12-13(18-15(20)24-9)19(2)16(23)21(14(12)22)8-10-3-5-11(17)6-4-10/h3-7,12H,8H2,1-2H3/q+1 |
| InChIKey | PBVDSNVPDKFPIK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|