C15H16N4O2S — CID 74526090
3,7-dimethyl-1-[(4-methylphenyl)methyl]-8-sulfanylidene-5H-purine-2,6-dione (PubChem CID 74526090) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 3,7-dimethyl-1-[(4-methylphenyl)methyl]-8-sulfanylidene-5H-purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[(4-methylphenyl)methyl]-8-sulfanylidene-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 74526090 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3,7-dimethyl-1-[(4-methylphenyl)methyl]-8-sulfanylidene-5H-purine-2,6-dione |
| SMILES | Cc1ccc(CN2C(=O)C3C(=NC(=S)N3C)N(C)C2=O)cc1 |
| InChI | InChI=1S/C15H16N4O2S/c1-9-4-6-10(7-5-9)8-19-13(20)11-12(18(3)15(19)21)16-14(22)17(11)2/h4-7,11H,8H2,1-3H3 |
| InChIKey | AOJAIEWISLLJGI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|