C16H23N6O3+ — CID 73280361
2-(6-butan-2-yl-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)acetamide (PubChem CID 73280361) has the molecular formula C16H23N6O3+ and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-(6-butan-2-yl-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)acetamide.
| Compound Name | 2-(6-butan-2-yl-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 73280361 |
| Molecular Formula | C16H23N6O3+ |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(6-butan-2-yl-4,7,8-trimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl)acetamide |
| SMILES | CCC(C)n1c(C)c(C)[n+]2c1N=C1C2C(=O)N(CC(N)=O)C(=O)N1C |
| InChI | InChI=1S/C16H22N6O3/c1-6-8(2)21-9(3)10(4)22-12-13(18-15(21)22)19(5)16(25)20(14(12)24)7-11(17)23/h8,12H,6-7H2,1-5H3,(H-,17,23)/p+1 |
| InChIKey | SXRWLMAQNWGKMH-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|