C20H30N5O3+ — CID 73280104
6-butan-2-yl-2-(3,3-dimethyl-2-oxobutyl)-4,7,8-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73280104) has the molecular formula C20H30N5O3+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 6-butan-2-yl-2-(3,3-dimethyl-2-oxobutyl)-4,7,8-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-butan-2-yl-2-(3,3-dimethyl-2-oxobutyl)-4,7,8-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73280104 |
| Molecular Formula | C20H30N5O3+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 6-butan-2-yl-2-(3,3-dimethyl-2-oxobutyl)-4,7,8-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | CCC(C)n1c(C)c(C)[n+]2c1N=C1C2C(=O)N(CC(=O)C(C)(C)C)C(=O)N1C |
| InChI | InChI=1S/C20H30N5O3/c1-9-11(2)24-12(3)13(4)25-15-16(21-18(24)25)22(8)19(28)23(17(15)27)10-14(26)20(5,6)7/h11,15H,9-10H2,1-8H3/q+1 |
| InChIKey | AQXIUTWHGXLZNW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|