C20H21ClN5O4+ — CID 78415211
6-(5-chloro-2-methoxyphenyl)-4,7,8-trimethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 78415211) has the molecular formula C20H21ClN5O4+ and a molecular weight of 430.87 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)-4,7,8-trimethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)-4,7,8-trimethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78415211 |
| Molecular Formula | C20H21ClN5O4+ |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)-4,7,8-trimethyl-2-(2-oxopropyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)c(C)[n+]2c1N=C1C2C(=O)N(CC(C)=O)C(=O)N1C |
| InChI | InChI=1S/C20H21ClN5O4/c1-10(27)9-24-18(28)16-17(23(4)20(24)29)22-19-25(11(2)12(3)26(16)19)14-8-13(21)6-7-15(14)30-5/h6-8,16H,9H2,1-5H3/q+1 |
| InChIKey | PAMRFYIVZKTINQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|