C19H22N5O3+ — CID 78413672
6-(2-ethoxyphenyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 78413672) has the molecular formula C19H22N5O3+ and a molecular weight of 368.42 g/mol. Its IUPAC name is 6-(2-ethoxyphenyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(2-ethoxyphenyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78413672 |
| Molecular Formula | C19H22N5O3+ |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-(2-ethoxyphenyl)-2,4,7,8-tetramethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | CCOc1ccccc1-n1c(C)c(C)[n+]2c1N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C19H22N5O3/c1-6-27-14-10-8-7-9-13(14)23-11(2)12(3)24-15-16(20-18(23)24)21(4)19(26)22(5)17(15)25/h7-10,15H,6H2,1-5H3/q+1 |
| InChIKey | XMGCUYIBAUDNAC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|