C18H21ClN5O6+ — CID 74526063
2-[[7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]amino]acetic acid (PubChem CID 74526063) has the molecular formula C18H21ClN5O6+ and a molecular weight of 438.85 g/mol. Its IUPAC name is 2-[[7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]amino]acetic acid.
| Compound Name | 2-[[7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]amino]acetic acid |
|---|---|
| PubChem CID | 74526063 |
| Molecular Formula | C18H21ClN5O6+ |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[[7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]amino]acetic acid |
| SMILES | CN1C(=O)C2C(=NC(NCC(=O)O)=[N+]2CC(O)COc2ccccc2Cl)N(C)C1=O |
| InChI | InChI=1S/C18H20ClN5O6/c1-22-15-14(16(28)23(2)18(22)29)24(17(21-15)20-7-13(26)27)8-10(25)9-30-12-6-4-3-5-11(12)19/h3-6,10,14,25H,7-9H2,1-2H3,(H,26,27)/p+1 |
| InChIKey | JJFSBOPZWFKNKF-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|