C19H24ClN5O4 — CID 91901250
8-(butylamino)-7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 91901250) has the molecular formula C19H24ClN5O4 and a molecular weight of 421.89 g/mol. Its IUPAC name is 8-(butylamino)-7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(butylamino)-7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 91901250 |
| Molecular Formula | C19H24ClN5O4 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 8-(butylamino)-7-[3-(2-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | CCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(O)COc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClN5O4/c1-3-4-9-21-18-22-16-15(17(27)23-19(28)24(16)2)25(18)10-12(26)11-29-14-8-6-5-7-13(14)20/h5-8,12,26H,3-4,9-11H2,1-2H3,(H,21,22)(H,23,27,28) |
| InChIKey | LPEKCXIYPOLGBQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|