C21H30N5O5+ — CID 73327638
7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73327638) has the molecular formula C21H30N5O5+ and a molecular weight of 432.50 g/mol. Its IUPAC name is 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73327638 |
| Molecular Formula | C21H30N5O5+ |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 7-[3-(3,4-dimethylphenoxy)-2-hydroxypropyl]-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1ccc(OCC(O)C[N+]2=C(NCCCO)N=C3C2C(=O)N(C)C(=O)N3C)cc1C |
| InChI | InChI=1S/C21H29N5O5/c1-13-6-7-16(10-14(13)2)31-12-15(28)11-26-17-18(23-20(26)22-8-5-9-27)24(3)21(30)25(4)19(17)29/h6-7,10,15,17,27-28H,5,8-9,11-12H2,1-4H3/p+1 |
| InChIKey | QXJZGYJKZYOINK-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|