C19H26N5O5+ — CID 78346818
7-(2-hydroxy-3-phenoxypropyl)-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78346818) has the molecular formula C19H26N5O5+ and a molecular weight of 404.45 g/mol. Its IUPAC name is 7-(2-hydroxy-3-phenoxypropyl)-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-hydroxy-3-phenoxypropyl)-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78346818 |
| Molecular Formula | C19H26N5O5+ |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 7-(2-hydroxy-3-phenoxypropyl)-8-(3-hydroxypropylamino)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(NCCCO)=[N+]2CC(O)COc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C19H25N5O5/c1-22-16-15(17(27)23(2)19(22)28)24(18(21-16)20-9-6-10-25)11-13(26)12-29-14-7-4-3-5-8-14/h3-5,7-8,13,15,25-26H,6,9-12H2,1-2H3/p+1 |
| InChIKey | AGUVLUNIFNLNLF-UHFFFAOYSA-O |
| XLogP | -0.93 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|