C20H24N5O3+ — CID 167999213
9-(2-methoxyphenyl)-1-methyl-3-(2-methylprop-2-enyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 167999213) has the molecular formula C20H24N5O3+ and a molecular weight of 382.44 g/mol. Its IUPAC name is 9-(2-methoxyphenyl)-1-methyl-3-(2-methylprop-2-enyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-(2-methoxyphenyl)-1-methyl-3-(2-methylprop-2-enyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 167999213 |
| Molecular Formula | C20H24N5O3+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 9-(2-methoxyphenyl)-1-methyl-3-(2-methylprop-2-enyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | C=C(C)CN1C(=O)C2C(=NC3=[N+]2CCCN3c2ccccc2OC)N(C)C1=O |
| InChI | InChI=1S/C20H24N5O3/c1-13(2)12-25-18(26)16-17(22(3)20(25)27)21-19-23(10-7-11-24(16)19)14-8-5-6-9-15(14)28-4/h5-6,8-9,16H,1,7,10-12H2,2-4H3/q+1 |
| InChIKey | MSMKPBCBEVNWRV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|