C14H17N4O3+ — CID 78370446
4,7,8-trimethyl-2-(2-methylprop-2-enyl)-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione (PubChem CID 78370446) has the molecular formula C14H17N4O3+ and a molecular weight of 289.32 g/mol. Its IUPAC name is 4,7,8-trimethyl-2-(2-methylprop-2-enyl)-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione.
| Compound Name | 4,7,8-trimethyl-2-(2-methylprop-2-enyl)-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78370446 |
| Molecular Formula | C14H17N4O3+ |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4,7,8-trimethyl-2-(2-methylprop-2-enyl)-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
| SMILES | C=C(C)CN1C(=O)C2C(=Nc3oc(C)c(C)[n+]32)N(C)C1=O |
| InChI | InChI=1S/C14H17N4O3/c1-7(2)6-17-12(19)10-11(16(5)14(17)20)15-13-18(10)8(3)9(4)21-13/h10H,1,6H2,2-5H3/q+1 |
| InChIKey | SPWPIDSYMAUJGC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|