C20H29N6O2+ — CID 167999509
3-tert-butyl-9-methyl-1,7-bis(2-methylprop-2-enyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999509) has the molecular formula C20H29N6O2+ and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-tert-butyl-9-methyl-1,7-bis(2-methylprop-2-enyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3-tert-butyl-9-methyl-1,7-bis(2-methylprop-2-enyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999509 |
| Molecular Formula | C20H29N6O2+ |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 3-tert-butyl-9-methyl-1,7-bis(2-methylprop-2-enyl)-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | C=C(C)CN1N=C(C(C)(C)C)C[N+]2=C1N=C1C2C(=O)N(CC(=C)C)C(=O)N1C |
| InChI | InChI=1S/C20H29N6O2/c1-12(2)9-25-17(27)15-16(23(8)19(25)28)21-18-24(15)11-14(20(5,6)7)22-26(18)10-13(3)4/h15H,1,3,9-11H2,2,4-8H3/q+1 |
| InChIKey | VHUVRDAASPAMTQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|