C15H20N5O2+ — CID 78305513
4,6,7,8-tetramethyl-2-(2-methylprop-2-enyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 78305513) has the molecular formula C15H20N5O2+ and a molecular weight of 302.36 g/mol. Its IUPAC name is 4,6,7,8-tetramethyl-2-(2-methylprop-2-enyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 4,6,7,8-tetramethyl-2-(2-methylprop-2-enyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 78305513 |
| Molecular Formula | C15H20N5O2+ |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4,6,7,8-tetramethyl-2-(2-methylprop-2-enyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | C=C(C)CN1C(=O)C2C(=Nc3n2c(C)c(C)[n+]3C)N(C)C1=O |
| InChI | InChI=1S/C15H20N5O2/c1-8(2)7-19-13(21)11-12(18(6)15(19)22)16-14-17(5)9(3)10(4)20(11)14/h11H,1,7H2,2-6H3/q+1 |
| InChIKey | PRQRIHTWGQXYSU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|