C15H22N5O3+ — CID 73281173
6-(2-hydroxyethyl)-4,7,8-trimethyl-2-propyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73281173) has the molecular formula C15H22N5O3+ and a molecular weight of 320.37 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-4,7,8-trimethyl-2-propyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-(2-hydroxyethyl)-4,7,8-trimethyl-2-propyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73281173 |
| Molecular Formula | C15H22N5O3+ |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 6-(2-hydroxyethyl)-4,7,8-trimethyl-2-propyl-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | CCCN1C(=O)C2C(=Nc3n2c(C)c(C)[n+]3CCO)N(C)C1=O |
| InChI | InChI=1S/C15H22N5O3/c1-5-6-19-13(22)11-12(17(4)15(19)23)16-14-18(7-8-21)9(2)10(3)20(11)14/h11,21H,5-8H2,1-4H3/q+1 |
| InChIKey | HAIJATSHCFTAAQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 82.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|