C19H29N6O4+ — CID 73328407
6-(2-methoxyethyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 73328407) has the molecular formula C19H29N6O4+ and a molecular weight of 405.48 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 6-(2-methoxyethyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 73328407 |
| Molecular Formula | C19H29N6O4+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 6-(2-methoxyethyl)-4,7,8-trimethyl-2-(2-morpholin-4-ylethyl)-9aH-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | COCC[n+]1c(C)c(C)n2c1N=C1C2C(=O)N(CCN2CCOCC2)C(=O)N1C |
| InChI | InChI=1S/C19H29N6O4/c1-13-14(2)25-15-16(20-18(25)23(13)9-10-28-4)21(3)19(27)24(17(15)26)6-5-22-7-11-29-12-8-22/h15H,5-12H2,1-4H3/q+1 |
| InChIKey | CNFDCYQBAKCHNC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|