C19H28N7O4+ — CID 73283272
2-[4,7,8-trimethyl-6-(3-morpholin-4-ylpropyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]acetamide (PubChem CID 73283272) has the molecular formula C19H28N7O4+ and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-[4,7,8-trimethyl-6-(3-morpholin-4-ylpropyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]acetamide.
| Compound Name | 2-[4,7,8-trimethyl-6-(3-morpholin-4-ylpropyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]acetamide |
|---|---|
| PubChem CID | 73283272 |
| Molecular Formula | C19H28N7O4+ |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[4,7,8-trimethyl-6-(3-morpholin-4-ylpropyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-6-ium-2-yl]acetamide |
| SMILES | Cc1c(C)[n+](CCCN2CCOCC2)c2n1C1C(=O)N(CC(N)=O)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C19H27N7O4/c1-12-13(2)26-15-16(22(3)19(29)25(17(15)28)11-14(20)27)21-18(26)24(12)6-4-5-23-7-9-30-10-8-23/h15H,4-11H2,1-3H3,(H-,20,27)/p+1 |
| InChIKey | USHWIYCXJAQTDS-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|