C17H23N6O4+ — CID 73338384
methyl 2-[8-(3,5-diethylpyrazol-1-yl)-3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate (PubChem CID 73338384) has the molecular formula C17H23N6O4+ and a molecular weight of 375.41 g/mol. Its IUPAC name is methyl 2-[8-(3,5-diethylpyrazol-1-yl)-3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate.
| Compound Name | methyl 2-[8-(3,5-diethylpyrazol-1-yl)-3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate |
|---|---|
| PubChem CID | 73338384 |
| Molecular Formula | C17H23N6O4+ |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | methyl 2-[8-(3,5-diethylpyrazol-1-yl)-3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetate |
| SMILES | CCc1cc(CC)n(C2=[N+](C)C3C(=O)N(CC(=O)OC)C(=O)N(C)C3=N2)n1 |
| InChI | InChI=1S/C17H23N6O4/c1-6-10-8-11(7-2)23(19-10)16-18-14-13(20(16)3)15(25)22(9-12(24)27-5)17(26)21(14)4/h8,13H,6-7,9H2,1-5H3/q+1 |
| InChIKey | CDZIYALEWRSQHX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|