C8H13N3O — CID 91622965
3,5-diethylpyrazole-1-carboxamide (PubChem CID 91622965) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,5-diethylpyrazole-1-carboxamide.
| Compound Name | 3,5-diethylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 91622965 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3,5-diethylpyrazole-1-carboxamide |
| SMILES | CCc1cc(CC)n(C(N)=O)n1 |
| InChI | InChI=1S/C8H13N3O/c1-3-6-5-7(4-2)11(10-6)8(9)12/h5H,3-4H2,1-2H3,(H2,9,12) |
| InChIKey | IJMCQHTUJOGOHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |