C12H20N2O2 — CID 82693116
ethyl 3-(3,5-diethylpyrazol-1-yl)propanoate (PubChem CID 82693116) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl 3-(3,5-diethylpyrazol-1-yl)propanoate.
| Compound Name | ethyl 3-(3,5-diethylpyrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 82693116 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | ethyl 3-(3,5-diethylpyrazol-1-yl)propanoate |
| SMILES | CCOC(=O)CCn1nc(CC)cc1CC |
| InChI | InChI=1S/C12H20N2O2/c1-4-10-9-11(5-2)14(13-10)8-7-12(15)16-6-3/h9H,4-8H2,1-3H3 |
| InChIKey | CSPCCZYPVMVNHG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |