C12H22N4O — CID 82695391
5-(3,5-diethylpyrazol-1-yl)-N'-hydroxypentanimidamide (PubChem CID 82695391) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 5-(3,5-diethylpyrazol-1-yl)-N'-hydroxypentanimidamide.
| Compound Name | 5-(3,5-diethylpyrazol-1-yl)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 82695391 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 5-(3,5-diethylpyrazol-1-yl)-N'-hydroxypentanimidamide |
| SMILES | CCc1cc(CC)n(CCCC/C(N)=N/O)n1 |
| InChI | InChI=1S/C12H22N4O/c1-3-10-9-11(4-2)16(14-10)8-6-5-7-12(13)15-17/h9,17H,3-8H2,1-2H3,(H2,13,15) |
| InChIKey | ASXWKORDWBUBNE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|