C17H21FN2O — CID 82695681
4-(3,5-diethylpyrazol-1-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 82695681) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(3,5-diethylpyrazol-1-yl)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(3,5-diethylpyrazol-1-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 82695681 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-(3,5-diethylpyrazol-1-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | CCc1cc(CC)n(CCCC(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H21FN2O/c1-3-15-12-16(4-2)20(19-15)11-5-6-17(21)13-7-9-14(18)10-8-13/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | QNFDKIGADFYJKV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |