C12H22N2O — CID 106458013
3,5-diethyl-1-(2-propoxyethyl)pyrazole (PubChem CID 106458013) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 3,5-diethyl-1-(2-propoxyethyl)pyrazole.
| Compound Name | 3,5-diethyl-1-(2-propoxyethyl)pyrazole |
|---|---|
| PubChem CID | 106458013 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3,5-diethyl-1-(2-propoxyethyl)pyrazole |
| SMILES | CCCOCCn1nc(CC)cc1CC |
| InChI | InChI=1S/C12H22N2O/c1-4-8-15-9-7-14-12(6-3)10-11(5-2)13-14/h10H,4-9H2,1-3H3 |
| InChIKey | UXWOMBZOEFLWBH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|