C13H24N2 — CID 82698927
1-(3,3-dimethylbutyl)-3,5-diethylpyrazole (PubChem CID 82698927) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole.
| Compound Name | 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole |
|---|---|
| PubChem CID | 82698927 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(CCC(C)(C)C)n1 |
| InChI | InChI=1S/C13H24N2/c1-6-11-10-12(7-2)15(14-11)9-8-13(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | NEZIQRGTWIUOHU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |