C13H23ClN2 — CID 82693006
1-(5-chloro-3-methylpentyl)-3,5-diethylpyrazole (PubChem CID 82693006) has the molecular formula C13H23ClN2 and a molecular weight of 242.79 g/mol. Its IUPAC name is 1-(5-chloro-3-methylpentyl)-3,5-diethylpyrazole.
| Compound Name | 1-(5-chloro-3-methylpentyl)-3,5-diethylpyrazole |
|---|---|
| PubChem CID | 82693006 |
| Molecular Formula | C13H23ClN2 |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(5-chloro-3-methylpentyl)-3,5-diethylpyrazole |
| SMILES | CCc1cc(CC)n(CCC(C)CCCl)n1 |
| InChI | InChI=1S/C13H23ClN2/c1-4-12-10-13(5-2)16(15-12)9-7-11(3)6-8-14/h10-11H,4-9H2,1-3H3 |
| InChIKey | VMFBVRROTHQRLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|