C11H20N2S — CID 82700558
3-(3,5-diethylpyrazol-1-yl)-2-methylpropane-1-thiol (PubChem CID 82700558) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-(3,5-diethylpyrazol-1-yl)-2-methylpropane-1-thiol.
| Compound Name | 3-(3,5-diethylpyrazol-1-yl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 82700558 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-(3,5-diethylpyrazol-1-yl)-2-methylpropane-1-thiol |
| SMILES | CCc1cc(CC)n(CC(C)CS)n1 |
| InChI | InChI=1S/C11H20N2S/c1-4-10-6-11(5-2)13(12-10)7-9(3)8-14/h6,9,14H,4-5,7-8H2,1-3H3 |
| InChIKey | SPSJQTGNACGTAG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|