C11H20N2O — CID 82694356
1-(3,5-diethylpyrazol-1-yl)butan-2-ol (PubChem CID 82694356) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(3,5-diethylpyrazol-1-yl)butan-2-ol.
| Compound Name | 1-(3,5-diethylpyrazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 82694356 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(3,5-diethylpyrazol-1-yl)butan-2-ol |
| SMILES | CCc1cc(CC)n(CC(O)CC)n1 |
| InChI | InChI=1S/C11H20N2O/c1-4-9-7-10(5-2)13(12-9)8-11(14)6-3/h7,11,14H,4-6,8H2,1-3H3 |
| InChIKey | ASEHNFGRSFETLR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |