C17H22N2O2 — CID 82698498
1-[2-[2-(3,5-diethylpyrazol-1-yl)ethoxy]phenyl]ethanone (PubChem CID 82698498) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-[2-[2-(3,5-diethylpyrazol-1-yl)ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-(3,5-diethylpyrazol-1-yl)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 82698498 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[2-[2-(3,5-diethylpyrazol-1-yl)ethoxy]phenyl]ethanone |
| SMILES | CCc1cc(CC)n(CCOc2ccccc2C(C)=O)n1 |
| InChI | InChI=1S/C17H22N2O2/c1-4-14-12-15(5-2)19(18-14)10-11-21-17-9-7-6-8-16(17)13(3)20/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | XGCKBDMZLLMTKN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |