C13H18N2O2 — CID 65250241
1-[2-[2-(3-aminoazetidin-1-yl)ethoxy]phenyl]ethanone (PubChem CID 65250241) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[2-[2-(3-aminoazetidin-1-yl)ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-(3-aminoazetidin-1-yl)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 65250241 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-[2-[2-(3-aminoazetidin-1-yl)ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OCCN1CC(N)C1 |
| InChI | InChI=1S/C13H18N2O2/c1-10(16)12-4-2-3-5-13(12)17-7-6-15-8-11(14)9-15/h2-5,11H,6-9,14H2,1H3 |
| InChIKey | NMUIITPEQXJJLZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |