C18H27NO2 — CID 62204691
1-[2-[2-(4-propylpiperidin-1-yl)ethoxy]phenyl]ethanone (PubChem CID 62204691) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[2-[2-(4-propylpiperidin-1-yl)ethoxy]phenyl]ethanone.
| Compound Name | 1-[2-[2-(4-propylpiperidin-1-yl)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 62204691 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-[2-[2-(4-propylpiperidin-1-yl)ethoxy]phenyl]ethanone |
| SMILES | CCCC1CCN(CCOc2ccccc2C(C)=O)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-3-6-16-9-11-19(12-10-16)13-14-21-18-8-5-4-7-17(18)15(2)20/h4-5,7-8,16H,3,6,9-14H2,1-2H3 |
| InChIKey | OZHROZNMSNGIRM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |