C17H25N3O — CID 82696077
[2-[3-(3,5-diethylpyrazol-1-yl)propoxy]phenyl]methanamine (PubChem CID 82696077) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is [2-[3-(3,5-diethylpyrazol-1-yl)propoxy]phenyl]methanamine.
| Compound Name | [2-[3-(3,5-diethylpyrazol-1-yl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 82696077 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [2-[3-(3,5-diethylpyrazol-1-yl)propoxy]phenyl]methanamine |
| SMILES | CCc1cc(CC)n(CCCOc2ccccc2CN)n1 |
| InChI | InChI=1S/C17H25N3O/c1-3-15-12-16(4-2)20(19-15)10-7-11-21-17-9-6-5-8-14(17)13-18/h5-6,8-9,12H,3-4,7,10-11,13,18H2,1-2H3 |
| InChIKey | VOFSKIZEFBQQMQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|