C17H28N2O2 — CID 61218601
[2-[3-(4-ethoxypiperidin-1-yl)propoxy]phenyl]methanamine (PubChem CID 61218601) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is [2-[3-(4-ethoxypiperidin-1-yl)propoxy]phenyl]methanamine.
| Compound Name | [2-[3-(4-ethoxypiperidin-1-yl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 61218601 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [2-[3-(4-ethoxypiperidin-1-yl)propoxy]phenyl]methanamine |
| SMILES | CCOC1CCN(CCCOc2ccccc2CN)CC1 |
| InChI | InChI=1S/C17H28N2O2/c1-2-20-16-8-11-19(12-9-16)10-5-13-21-17-7-4-3-6-15(17)14-18/h3-4,6-7,16H,2,5,8-14,18H2,1H3 |
| InChIKey | LSNITRQXCHRADC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|